Skip to main content
United StatesCalculusSyllabus dot point

How does the average rate of change over an interval become the instantaneous rate of change at a point?

Topic 2.1 Defining Average and Instantaneous Rates of Change at a Point: compute the average rate of change over an interval and define the instantaneous rate of change as the limit of average rates.

A focused answer to AP Calculus AB Topic 2.1, defining average rate of change as a secant slope and the instantaneous rate as its limit (the derivative), with worked secant-to-tangent examples.

Generated by Claude Opus 4.88 min answer

Reviewed by: AI editorial process; not yet individually human-reviewed

Have a quick question? Jump to the Q&A page

Jump to a section
  1. What this topic is asking
  2. Average rate of change
  3. Instantaneous rate of change
  4. From secant to tangent
  5. The secant-line and tangent-line picture
  6. Why both rates matter

What this topic is asking

The College Board (Topic 2.1) opens Unit 2 by making the Unit 1 idea precise: the average rate of change over an interval is the slope of a secant line, and the instantaneous rate of change at a point is the limit of those secant slopes as the interval shrinks. That limit is the derivative, which the next topic names.

Average rate of change

It is a single number summarizing how much the output changed per unit of input across the whole interval, ignoring what happened in between.

Instantaneous rate of change

So the secant slope is what you can compute directly; the tangent slope is what the limit delivers.

From secant to tangent

Picture fixing the point (a,f(a))(a, f(a)) and sliding the second point (a+h,f(a+h))(a+h, f(a+h)) toward it. Each position gives a secant line with a slope equal to an average rate of change. As h→0h \to 0 the second point merges with the first, and the secant lines converge on a single line touching the curve at (a,f(a))(a, f(a)): the tangent. Its slope is the instantaneous rate.

The secant-line and tangent-line picture

It helps to anchor both rates to lines on the graph of y=f(x)y = f(x). The average rate of change over [a,b][a, b] is the slope of the secant line, the straight line cutting the curve at the two endpoints. The instantaneous rate at x=ax = a is the slope of the tangent line, the line that just grazes the curve at that one point. As you hold (a,f(a))(a, f(a)) fixed and let the second point slide in toward it, the secant lines tilt continuously and approach the tangent line as their limiting position; their slopes (the average rates) approach the tangent slope (the instantaneous rate). This is the geometric content of the limit lim⁑hβ†’0f(a+h)βˆ’f(a)h\lim_{h \to 0} \frac{f(a+h) - f(a)}{h}, and it is why being able to find a tangent slope is the same skill as finding an instantaneous rate of change.

Why both rates matter

The average rate answers "how fast on average across the interval"; the instantaneous rate answers "how fast exactly at this moment". Velocity, marginal cost, and reaction rates are all instantaneous rates obtained as limits of averages. Topic 2.1 sets up the limit; Topic 2.2 names it the derivative and gives the formal notation. In motion problems specifically, the average rate of position is average velocity and the instantaneous rate is the velocity reading at that instant, so the two ideas correspond to the difference between "how far per hour on the whole trip" and "what the speedometer shows right now". Keeping the interval-versus-instant distinction sharp prevents the frequent confusion of reporting an average when the question asks for an instantaneous value, or setting up a single secant slope when the question wants the limit.

Exam-style practice questions

Practice questions written in the style of College Board exam questions on this dot point, with worked answer explainers. The year tag is the paper they imitate, not the source.

AP 2022 (style)1 marksSection I (multiple choice, no calculator). For f(x)=x2+1f(x) = x^2 + 1, the average rate of change on [1,3][1, 3] is (A) 22 (B) 44 (C) 66 (D) 88
Show worked answer β†’

The correct answer is (B), 44.

The average rate of change on [1,3][1, 3] is f(3)βˆ’f(1)3βˆ’1=(9+1)βˆ’(1+1)2=10βˆ’22=82=4\frac{f(3) - f(1)}{3 - 1} = \frac{(9 + 1) - (1 + 1)}{2} = \frac{10 - 2}{2} = \frac{8}{2} = 4. This is the slope of the secant line joining (1,2)(1, 2) and (3,10)(3, 10).

AP 2023 (style)3 marksSection II (free response, no calculator). A particle has position s(t)=t2+2ts(t) = t^2 + 2t meters at time tt seconds. (a) Find the average velocity on [1,3][1, 3]. (b) Write the limit definition for the instantaneous velocity at t=1t = 1. (c) Evaluate that limit.
Show worked answer β†’

A 3-point average-to-instantaneous question.

(a) (1 point) Average velocity =s(3)βˆ’s(1)3βˆ’1=15βˆ’32=6= \frac{s(3) - s(1)}{3 - 1} = \frac{15 - 3}{2} = 6 m/s.
(b) (1 point) Instantaneous velocity at t=1t = 1 is lim⁑hβ†’0s(1+h)βˆ’s(1)h\lim_{h \to 0} \frac{s(1+h) - s(1)}{h}.
(c) (1 point) s(1+h)=(1+h)2+2(1+h)=1+2h+h2+2+2h=3+4h+h2s(1+h) = (1+h)^2 + 2(1+h) = 1 + 2h + h^2 + 2 + 2h = 3 + 4h + h^2, so s(1+h)βˆ’s(1)h=4h+h2h=4+hβ†’4\frac{s(1+h) - s(1)}{h} = \frac{4h + h^2}{h} = 4 + h \to 4 m/s.

Related dot points

Sources & how we know this